CAS 1423034-01-8

Benzenemethanamine, N-(4-bromophenyl)-4-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, N-(4-bromophenyl)-4-(trifluoromethyl)-, hydrochloride (1:1), with the CAS number 1423034-01-8, is a chemical compound characterized by its amine functional group and the presence of both bromine and trifluoromethyl substituents on the aromatic ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the hydrochloride salt form. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The bromine substituent can also impart unique reactivity and stability characteristics. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound may exhibit various properties, including potential antimicrobial or anticancer activities, which are common in compounds with similar structural features. However, specific biological activities and applications would require further investigation through experimental studies.

Formula: C₁₄H₁₁BrF₃N·ClH

InChI: InChI=1S/C14H11BrF3N.ClH/c15-12-5-7-13(8-6-12)19-9-10-1-3-11(4-2-10)14(16,17)18;/h1-8,19H,9H2;1H

InChI key: InChIKey=VVOXJAAUEOOVQP-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(Br)C=C1)C2=CC=C(C(F)(F)F)C=C2.Cl

Synonyms:

• Benzenemethanamine, N-(4-bromophenyl)-4-(trifluoromethyl)-, hydrochloride (1:1)

4-Bromo-N-{[4-(trifluoromethyl)phenyl]methyl}aniline hydrochloride

CAS: 1423034-01-8

Versatile small molecule scaffold

Formula: C₁₄H₁₂BrClF₃N

Purity: Min. 95%

Molecular weight: 366.6 g/mol

Ref: 3D-YGC03401