CymitQuimica logo

CAS 1426958-37-3

:

1-(4-Bromo-3-chlorophenyl)-4-methylpiperazine

Description:
1-(4-Bromo-3-chlorophenyl)-4-methylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 4-bromo-3-chlorophenyl group indicates that the compound has significant halogen substituents, which can influence its reactivity and biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological systems, making it of interest in medicinal chemistry. Its structure suggests that it could act as a ligand for various receptors, potentially influencing neurotransmitter systems. The presence of halogens often enhances lipophilicity, which can affect the compound's pharmacokinetics. Additionally, the specific arrangement of substituents can lead to unique stereochemical properties, impacting its biological efficacy. Overall, 1-(4-Bromo-3-chlorophenyl)-4-methylpiperazine is a compound of interest for further research, particularly in the fields of drug development and pharmacology.
Formula:C11H14BrClN2
InChI:InChI=1S/C11H14BrClN2/c1-14-4-6-15(7-5-14)9-2-3-10(12)11(13)8-9/h2-3,8H,4-7H2,1H3
InChI key:InChIKey=MXYFKZPPPWIQFU-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1Br)N2CCN(C)CC2
Synonyms:
  • Piperazine, 1-(4-bromo-3-chlorophenyl)-4-methyl-
  • 1-(4-Bromo-3-chlorophenyl)-4-methylpiperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.