CAS 143159-04-0
:6,7-dimethoxy-2-methylquinoxaline
Description:
6,7-Dimethoxy-2-methylquinoxaline is a chemical compound belonging to the quinoxaline family, characterized by its bicyclic structure that includes two fused aromatic rings. This compound features two methoxy groups (-OCH3) at the 6 and 7 positions and a methyl group (-CH3) at the 2 position of the quinoxaline ring. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on its specific molecular interactions. The presence of methoxy groups can influence its reactivity and polarity, making it potentially useful in various chemical applications, including medicinal chemistry and material science. Quinoxaline derivatives are often studied for their biological activities, including antimicrobial and anticancer properties. The compound's unique structure may also allow it to participate in various chemical reactions, making it a subject of interest in synthetic organic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H12N2O2
InChI:InChI=1/C11H12N2O2/c1-7-6-12-8-4-10(14-2)11(15-3)5-9(8)13-7/h4-6H,1-3H3
SMILES:Cc1cnc2cc(c(cc2n1)OC)OC
Synonyms:- 6,7-Dmomq
- Quinoxaline, 6,7-dimethoxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.