CymitQuimica logo

CAS 1439902-92-7

:

1-[(3-Bromophenyl)methyl]-1H-imidazole-4-carboxylic acid

Description:
1-[(3-Bromophenyl)methyl]-1H-imidazole-4-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromophenyl group indicates that a bromine atom is substituted on the phenyl ring, contributing to the compound's unique reactivity and potential biological activity. The carboxylic acid functional group (-COOH) attached to the imidazole ring enhances its acidity and solubility in polar solvents, making it suitable for various applications in medicinal chemistry and organic synthesis. This compound may exhibit interesting pharmacological properties due to the combination of the imidazole and bromophenyl moieties, which can influence its interaction with biological targets. Additionally, the presence of the bromine atom can enhance lipophilicity and affect the compound's overall stability and reactivity. Overall, this compound's structural features suggest potential utility in drug development and research into new therapeutic agents.
Formula:C11H9BrN2O2
InChI:InChI=1S/C11H9BrN2O2/c12-9-3-1-2-8(4-9)5-14-6-10(11(15)16)13-7-14/h1-4,6-7H,5H2,(H,15,16)
InChI key:InChIKey=YCRUDBCKGBVWAF-UHFFFAOYSA-N
SMILES:C(N1C=C(C(O)=O)N=C1)C2=CC(Br)=CC=C2
Synonyms:
  • 1-[(3-Bromophenyl)methyl]-1H-imidazole-4-carboxylic acid
  • 1H-Imidazole-4-carboxylic acid, 1-[(3-bromophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.