CAS 1451391-03-9

B-[4-Methyl-6-(1-methylethoxy)-3-pyridinyl]boronic acid

Description:

B-[4-Methyl-6-(1-methylethoxy)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a methyl group and an ethoxy group, contributing to its unique chemical properties and potential applications in medicinal chemistry and organic synthesis. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the presence of the ethoxy group may enhance solubility and reactivity in various solvents. The compound's structure suggests potential biological activity, particularly in the context of drug development, where boronic acids are often explored for their ability to interact with biological targets. Overall, B-[4-Methyl-6-(1-methylethoxy)-3-pyridinyl]boronic acid exemplifies the versatility of boron-containing compounds in both synthetic and pharmaceutical chemistry.

Formula: C₉H₁₄BNO₃

InChI: InChI=1S/C9H14BNO3/c1-6(2)14-9-4-7(3)8(5-11-9)10(12)13/h4-6,12-13H,1-3H3

InChI key: InChIKey=IIKDFLHYLHDMHY-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C(C)=CC(OC(C)C)=NC1

Synonyms:

• B-[4-Methyl-6-(1-methylethoxy)-3-pyridinyl]boronic acid
• Boronic acid, B-[4-methyl-6-(1-methylethoxy)-3-pyridinyl]-

2-Isopropoxy-4-methylpyridine-5-boronic acid

CAS: 1451391-03-9

Purity: ≥95%

Molecular weight: 195.0299988

Ref: 10-F627896