
CAS 1467060-02-1
:1-[3-[4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]-1-azetidinyl]ethanone
Description:
1-[3-[4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]-1-azetidinyl]ethanone, with CAS number 1467060-02-1, is a synthetic organic compound that features a complex molecular structure incorporating a boron-containing moiety. The presence of a dioxaborinane ring suggests potential applications in medicinal chemistry, particularly in drug design and development, due to the unique reactivity and properties of boron compounds. The azetidine ring contributes to the compound's cyclic structure, which can influence its biological activity and pharmacokinetics. The phenoxy group enhances the compound's lipophilicity, potentially improving membrane permeability. Overall, this compound may exhibit interesting biological properties, making it a candidate for further research in therapeutic applications. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its structure and purity. As with many synthetic compounds, understanding its reactivity and interactions with biological systems is crucial for evaluating its potential uses.
Formula:C16H22BNO4
InChI:InChI=1S/C16H22BNO4/c1-12(19)18-8-15(9-18)22-14-6-4-13(5-7-14)17-20-10-16(2,3)11-21-17/h4-7,15H,8-11H2,1-3H3
InChI key:InChIKey=BETZJMWEJCTSQY-UHFFFAOYSA-N
SMILES:O(C1CN(C(C)=O)C1)C2=CC=C(C=C2)B3OCC(C)(C)CO3
Synonyms:- 1-[3-[4-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]-1-azetidinyl]ethanone
- Ethanone, 1-[3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]-1-azetidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.