CAS 14796-95-3
:Strontium palmitate
Description:
Strontium palmitate is a chemical compound formed from strontium and palmitic acid, a saturated fatty acid. It is typically represented by the formula Sr(C16H31O2)2, indicating that it consists of strontium ions paired with two palmitate anions. This compound is a white, waxy solid at room temperature and is insoluble in water but soluble in organic solvents, which makes it useful in various applications, including as a surfactant and emulsifier in cosmetic formulations. Strontium palmitate exhibits characteristics typical of metal salts of fatty acids, such as low toxicity and the ability to form stable emulsions. Additionally, it may have applications in the food industry as a food additive or in pharmaceuticals as a stabilizing agent. Its properties can be influenced by factors such as temperature and the presence of other substances, which can affect its solubility and stability. Overall, strontium palmitate is notable for its unique combination of strontium's metallic properties and the fatty acid's hydrophobic characteristics.
Formula:C16H32O2Sr
InChI:InChI=1S/C16H32O2.Sr/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);
InChI key:InChIKey=POAFJTBPGRVAFR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCC)CCCCC(O)=O.[Sr]
Synonyms:- Hexadecanoic acid, strontium salt (2:1)
- Strontium palmitate
- Palmitic acid, strontium salt
- Hexadecanoic acid, strontium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
