CAS 14932-25-3

(1S,2R,3S,4R)-3-aminonorbornane-2-carboxylic acid hydrochloride

Description:

(1S,2R,3S,4R)-3-aminonorbornane-2-carboxylic acid hydrochloride, with the CAS number 14932-25-3, is a chiral amino acid derivative characterized by its unique bicyclic structure, which is derived from norbornane. This compound features an amino group and a carboxylic acid functional group, making it an α-amino acid. The specific stereochemistry indicated by the (1S,2R,3S,4R) configuration suggests that it possesses multiple chiral centers, contributing to its potential biological activity and interactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and biochemical research. The presence of the amino and carboxylic acid groups allows for participation in peptide bond formation, making it relevant in the synthesis of peptides and proteins. Its stereochemical properties may also influence its interaction with biological systems, potentially affecting its pharmacological profile. Overall, this compound is of interest in medicinal chemistry and related fields due to its structural and functional characteristics.

Formula: C₈H₁₄ClNO₂

InChI: InChI=1/C8H13NO2.ClH/c9-7-5-2-1-4(3-5)6(7)8(10)11;/h4-7H,1-3,9H2,(H,10,11);1H/t4-,5+,6+,7-;/m0./s1