
CAS 1552-98-3
:Bicyclo[2.2.0]hexane
Description:
Bicyclo[2.2.0]hexane is a bicyclic organic compound characterized by its unique structure, which consists of two fused cyclopropane rings. This compound has a molecular formula of C6H10 and features a distinctive arrangement of carbon atoms that results in a highly strained system. The strain arises from the small ring sizes and the angles between the carbon-carbon bonds, leading to interesting reactivity and physical properties. Bicyclo[2.2.0]hexane is typically a colorless liquid at room temperature and exhibits a relatively low boiling point compared to larger cyclic hydrocarbons. It is insoluble in water but soluble in organic solvents. The compound is of interest in organic chemistry due to its potential as a building block for more complex molecules and its applications in materials science. Additionally, its unique structure makes it a subject of study in the field of strain theory and molecular stability. Safety precautions should be taken when handling this compound, as with many organic chemicals, due to its flammability and potential health hazards.
Formula:C6H4
InChI:InChI=1S/C6H4/c1-2-6-4-3-5(1)6/h1-4H
InChI key:InChIKey=YHCJOCYHUDCVQI-UHFFFAOYSA-N
SMILES:C12=C(C=C1)C=C2
Synonyms:- Butalene
- Bicyclo[2.2.0]hexa-1,3,5-triene
- Bicyclo[2.2.0]hexane
- Bicyclo[2.2.0]hexa-1(4),2,5-triene
- p-Benzyne
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
