CAS 15895-68-8

4-Cyano-2,3,5,6-tetrafluorobenzotrifluoride

Description:

4-Cyano-2,3,5,6-tetrafluorobenzotrifluoride, with the CAS number 15895-68-8, is a synthetic organic compound characterized by its complex fluorinated aromatic structure. This compound features a cyano group (-CN) and multiple fluorine atoms, which significantly influence its chemical properties, including increased electronegativity and reactivity. The presence of fluorine atoms enhances its thermal stability and resistance to chemical degradation, making it suitable for various industrial applications, particularly in the field of specialty chemicals and materials. The cyano group contributes to its polarity, affecting solubility and interaction with other substances. Additionally, this compound is likely to exhibit low volatility and high density due to its heavy halogen content. Its unique combination of functional groups makes it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fluorinated compounds. However, handling and usage require caution due to potential toxicity and environmental impact associated with fluorinated compounds.

Formula: C₈F₇N

InChI: InChI=1/C8F7N/c9-4-2(1-16)5(10)7(12)3(6(4)11)8(13,14)15

SMILES: C(#N)c1c(c(c(c(c1F)F)C(F)(F)F)F)F

Synonyms:

• 2,3,5,6-Tetrafluoro-4-(Trifluoromethyl)Benzonitrile

2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzonitrile

CAS: 15895-68-8

Formula: C₈F₇N

Molecular weight: 243.0811

Ref: IN-DA001R1B

2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzonitrile

CAS: 15895-68-8

2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzonitrile

Purity: ≥95%

Color and Shape: Low-Melting Solid

Molecular weight: 243.08g/mol

Ref: 54-PC408124