CAS 16165-32-5
:Tris(ethylenediamine)chromium(III) chloride hydrate
Description:
Tris(ethylenediamine)chromium(III) chloride hydrate, with the CAS number 16165-32-5, is a coordination compound featuring chromium in a +3 oxidation state, coordinated by three ethylenediamine (en) ligands. This complex typically appears as a colored solid, often exhibiting a deep green or violet hue due to the d-d electronic transitions of the chromium ion. The presence of water molecules in its hydrated form contributes to its stability and solubility in polar solvents, particularly water. The compound is known for its role in various chemical applications, including catalysis and as a precursor in the synthesis of other chromium complexes. Its coordination geometry is octahedral, a common arrangement for transition metal complexes, which influences its reactivity and interaction with other chemical species. Safety considerations should be taken into account, as chromium compounds can be toxic and pose environmental hazards. Proper handling and disposal methods are essential when working with this substance in laboratory settings.
Formula:C6H24Cl3CrN6
Synonyms:- Tris(ethylenediamine)chromium (III) chloride hemiheptahydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Tris(ethylenediamine)chromium(III) chloride hemiheptahydrate
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H24Cl3CrN6·5H2OMolecular weight:401.71 (338.65anhy)Tris(ethylenediamine)chromium(III) chloride hemiheptahydrate, min. 98%
CAS:<p>Tris(ethylenediamine)chromium(III) chloride hemiheptahydrate, min. 98%</p>Formula:Cr(H2NCH2CH2NH2)3Cl3·5H2OPurity:min. 98%Color and Shape:yellow pwdr.Molecular weight:338.65 (401.71)
