CymitQuimica logo

CAS 1619-84-7

:

hexafluoroacetone azine

Description:
Hexafluoroacetone azine is a chemical compound characterized by its unique structure and properties. It is derived from hexafluoroacetone, a highly fluorinated ketone, and azine, which is a class of compounds containing a nitrogen-nitrogen double bond. This compound is notable for its high stability and low volatility, making it useful in various chemical applications. Hexafluoroacetone azine exhibits strong polar characteristics due to the presence of fluorine atoms, which can influence its reactivity and interactions with other substances. It is typically colorless and may have a faint odor. The compound is soluble in organic solvents and is often used in the synthesis of other fluorinated compounds. Additionally, its unique electronic properties make it of interest in materials science and fluorine chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested. Overall, hexafluoroacetone azine is a significant compound in the field of fluorinated organic chemistry.
Formula:C6F12N2
InChI:InChI=1/C6F12N2/c7-3(8,9)1(4(10,11)12)19-20-2(5(13,14)15)6(16,17)18
SMILES:C(=NN=C(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F
Synonyms:
  • Bis[2,2,2-Trifluoro-1-(Trifluoromethyl)Ethylidene]Hydrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.