CAS 16228-00-5
:3-Hydroxymethyl-5,5-dimethylhydantoin
Description:
3-Hydroxymethyl-5,5-dimethylhydantoin (CAS 16228-00-5) is an organic compound that belongs to the hydantoin family, characterized by its five-membered ring structure containing both nitrogen and carbon atoms. This compound features a hydroxymethyl group and two methyl groups attached to the hydantoin ring, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which makes it useful in different applications. The presence of the hydroxymethyl group enhances its reactivity, allowing it to participate in various chemical reactions, including those involving formaldehyde. 3-Hydroxymethyl-5,5-dimethylhydantoin is often utilized as a biocide and preservative in industrial formulations, particularly in personal care products and cosmetics, due to its antimicrobial properties. Additionally, it can serve as a precursor in the synthesis of other chemical compounds. Safety data indicates that it should be handled with care, as with many chemical substances, to avoid potential health hazards.
Formula:C6H10N2O3
InChI:InChI=1S/C6H10N2O3/c1-6(2)4(10)8(3-9)5(11)7-6/h9H,3H2,1-2H3,(H,7,11)
InChI key:InChIKey=IVQCQIORBPXQGP-UHFFFAOYSA-N
SMILES:C(O)N1C(=O)C(C)(C)NC1=O
Synonyms:- Hydantoin, 3-(hydroxymethyl)-5,5-dimethyl-
- 3-Hydroxymethyl-5,5-dimethylhydantoin
- 4,4-Dimethyl-2,5-dioxo-1-imidazolidenemethanol
- 2,4-Imidazolidinedione, 3-(hydroxymethyl)-5,5-dimethyl-
- Monomethyloldimethylhydantoin
- 3-(Hydroxymethyl)-5,5-dimethyl-2,4-imidazolidinedione
- 3-(Hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4-Imidazolidinedione, 3-(hydroxymethyl)-5,5-dimethyl-
CAS:Formula:C6H10N2O3Molecular weight:158.1552
