
CAS 16231-75-7
:Atolide
Description:
Atolide, with the CAS number 16231-75-7, is a chemical compound that belongs to the class of organic compounds known as benzamides. It is characterized by its structural features, which typically include a benzene ring attached to an amide functional group. Atolide is primarily recognized for its application in the field of pharmaceuticals, particularly as an anti-inflammatory agent. The compound exhibits properties that may influence biological systems, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the specific conditions and formulations used. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or environmental impact. Research into Atolide's mechanisms of action and efficacy continues to enhance our understanding of its role in therapeutic applications. Overall, Atolide represents a significant compound within its category, contributing to advancements in drug development and therapeutic strategies.
Formula:C18H23N3O
InChI:InChI=1S/C18H23N3O/c1-4-21(5-2)14-10-11-17(13(3)12-14)20-18(22)15-8-6-7-9-16(15)19/h6-12H,4-5,19H2,1-3H3,(H,20,22)
InChI key:InChIKey=MMPYYZUCLBHNSK-UHFFFAOYSA-N
SMILES:C(NC1=C(C)C=C(N(CC)CC)C=C1)(=O)C2=C(N)C=CC=C2
Synonyms:- Atolide
- Goe 1213
- o-Benzotoluidide, 2-amino-4′-(diethylamino)-
- Benzamide, 2-amino-N-[4-(diethylamino)-2-methylphenyl]-
- 2-Amino-N-[4-(diethylamino)-2-methylphenyl]benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Atolide
CAS:<p>Atolide is a biochemical.</p>Formula:C18H23N3OColor and Shape:SolidMolecular weight:297.39
