CAS 162651-09-4: 2-(Ethylamino)-4-methyl-5-thiazolecarboxylic acid
Description:2-(Ethylamino)-4-methyl-5-thiazolecarboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethylamino group, contributing to its basicity and potential for forming salts. The presence of a carboxylic acid functional group indicates that it can act as an acid, participating in proton transfer reactions. The methyl group on the thiazole ring influences its steric and electronic properties, potentially affecting its reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and hydrophobic interactions, which can be crucial in drug design and development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-(Ethylamino)-4-methyl-5-thiazolecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C7H10N2O2S
InChI:InChI=1S/C7H10N2O2S/c1-3-8-7-9-4(2)5(12-7)6(10)11/h3H2,1-2H3,(H,8,9)(H,10,11)
InChI key:InChIKey=IKCWFYCMZBNCKA-UHFFFAOYSA-N
SMILES:O=C(O)C=1SC(=NC1C)NCC
- Synonyms:
- 2-(Ethylamino)-4-Methyl-1,3-Thiazole-5-Carboxylate
- 2-(Ethylamino)-4-Methyl-1,3-Thiazole-5-Carboxylic Acid
- 2-(Ethylamino)-4-methyl-5-thiazolecarboxylic acid
- 5-Thiazolecarboxylic acid, 2-(ethylamino)-4-methyl-
- Chembrdg-Bb 4010427
5-Thiazolecarboxylic acid, 2-(ethylamino)-4-methyl-
Ref: IN-DA001TAY
| 1g | 318.00 € | ||
| 250mg | 147.00 € |
2-Ethylamino-4-methyl-thiazole-5-carboxylic acid
Ref: 10-F041973
| 1g | To inquire | ||
| 250mg | To inquire |
2-Ethylamino-4-methyl-thiazole-5-carboxylic acid
Ref: 3D-MGA65109
| 10g | 531.00 € |
