CymitQuimica logo

CAS 163597-25-9

:

Antcin B

Description:
Antcin B, with the CAS number 163597-25-9, is a naturally occurring compound classified as a triterpenoid. It is primarily derived from certain species of fungi, particularly those belonging to the Antrodia genus. Antcin B exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it a subject of interest in pharmacological research. Its structure features a complex arrangement of carbon rings typical of triterpenoids, contributing to its diverse biological effects. The compound has been studied for its potential therapeutic applications, particularly in traditional medicine contexts. Additionally, Antcin B's interactions with various biological pathways highlight its significance in the development of novel therapeutic agents. As research continues, further elucidation of its mechanisms of action and potential applications in medicine is anticipated.
Formula:C29H40O5
InChI:InChI=1S/C29H40O5/c1-15(17(3)27(33)34)7-8-16(2)19-9-10-20-25-23(31)13-21-18(4)22(30)11-12-28(21,5)26(25)24(32)14-29(19,20)6/h16-21H,1,7-14H2,2-6H3,(H,33,34)/t16-,17?,18+,19-,20+,21+,28+,29-/m1/s1
InChI key:InChIKey=DVORYMAGXQGBQK-QCMFUGJUSA-N
SMILES:C[C@@]12C3=C([C@]4([C@](C)(CC3=O)[C@@]([C@@H](CCC(C(C(O)=O)C)=C)C)(CC4)[H])[H])C(=O)C[C@]1([C@H](C)C(=O)CC2)[H]
Synonyms:
  • Antcin B
  • (4α,5α)-4-Methyl-3,7,11-trioxoergosta-8,24(28)-dien-26-oic acid
  • Zhankuic acid A
  • (25R,S)-Zhankuic acid A
  • Ergosta-8,24(28)-dien-26-oic acid, 4-methyl-3,7,11-trioxo-, (4α,5α)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.