CymitQuimica logo

CAS 167637-41-4

:

Ethyl-5-(4-methoxy-2,3,6-trimethylphenyl)-3-methyl-2,4-pentadienoate

Description:
Ethyl-5-(4-methoxy-2,3,6-trimethylphenyl)-3-methyl-2,4-pentadienoate, with the CAS number 167637-41-4, is an organic compound characterized by its complex structure, which includes an ethyl ester functional group and a conjugated diene system. This compound features a methoxy-substituted aromatic ring, contributing to its potential reactivity and solubility properties. The presence of multiple methyl groups on the aromatic ring enhances its hydrophobic characteristics, while the diene system may allow for various chemical reactions, such as polymerization or addition reactions. Ethyl-5-(4-methoxy-2,3,6-trimethylphenyl)-3-methyl-2,4-pentadienoate is likely to exhibit moderate stability under standard conditions, but its reactivity can be influenced by environmental factors such as light and temperature. This compound may find applications in organic synthesis, particularly in the development of dyes, fragrances, or as an intermediate in the production of more complex molecules. As with many organic compounds, safety data should be consulted for handling and storage guidelines.
Formula:C18H24O3
InChI:InChI=1/C18H24O3/c1-7-21-18(19)10-12(2)8-9-16-13(3)11-17(20-6)15(5)14(16)4/h8-11H,7H2,1-6H3/b9-8+,12-10+
Synonyms:
  • 5-(4-Methoxy-2,3,6-trimethylphenyl)-3-methyl-2,4-pentadienoic Acid Ethyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.