CAS 17066-67-0
:β-selinene
Description:
β-Selinene is a naturally occurring sesquiterpene hydrocarbon, primarily found in various essential oils, particularly those derived from plants in the Apiaceae family. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties and potential biological activities. β-Selinene is typically colorless to pale yellow in appearance and has a distinctive aromatic odor. It is insoluble in water but soluble in organic solvents, making it useful in various applications, including perfumery and flavoring. The compound exhibits potential antimicrobial and anti-inflammatory properties, which have garnered interest in pharmacological research. Additionally, β-selinene can undergo various chemical reactions, such as oxidation and polymerization, under specific conditions, leading to the formation of different derivatives. Its presence in essential oils not only contributes to the fragrance but may also play a role in the plant's defense mechanisms against pests and pathogens. Overall, β-selinene is a significant compound in both natural product chemistry and potential therapeutic applications.
Formula:C15H24
InChI:InChI=1/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h13-14H,1,3,5-10H2,2,4H3/t13-,14+,15-/m1/s1
InChI key:InChIKey=YOVSPTNQHMDJAG-QLFBSQMISA-N
SMILES:C[C@]12[C@@](C[C@H](C(C)=C)CC1)(C(=C)CCC2)[H]
Synonyms:- (4AR,7R,8aS)-Decahydro-4a-methyl-1-methylene-7-(1-methylethenyl)naphthalene
- (4aR,7R,8aS)-4a-methyl-1-methylidene-7-(prop-1-en-2-yl)decahydronaphthalene
- (4aR-(4aalpha,7alpha,8abeta))- decahydro-4a-methyl-1-methylene-7-(1-methyl ethenyl) naphthalene
- (4aS,7S,8aR)-4a-methyl-1-methylidene-7-(prop-1-en-2-yl)decahydronaphthalene
- Beta- Eudesmene
- Beta-Selinene
- Decahydro-4a-methyl-1-methylene-7-(1-methylethenyl)-[4aR-(4aα,7α,8aβ)]-naphthalene
- Eudesma-4(14),11-Diene
- Naphthalene, decahydro-4a-methyl-1-methylene-7-(1-methylethenyl)-, (4aR,7R,8aS)-
- Naphthalene, decahydro-4a-methyl-1-methylene-7-(1-methylethenyl)-, [4aR-(4aα,7α,8aβ)]-
- Selina-4(14),11-Diene
- β-Eudesmene
- β-Selinene
- β-Selinene, (~90%)
- -Selinene
- (4aR,8aα)-Decahydro-4a-methyl-1-methylene-7β-(1-methylethenyl)naphthalene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
β-Selinene, (~90%)
CAS:Applications β-Selinene is a natural product found in essential oils from variety of plants. It is a functional antioxidant with antiradical and antimicrobial properties.
References Sacchetti, G., et al.: Food Chem., 91, 621 (2005); Bozin, B., et al.: J. Agric. Food Chem., 54, 1822 (2006);Formula:C15H24Purity:~90%Color and Shape:ColourlessMolecular weight:204.35Beta-selinene
CAS:Beta-selinene is a sesquiterpene compound, which is a naturally occurring organic product found in various plants. It is primarily sourced from essential oils of certain herbs and woody plants such as celery and carrots. The mode of action of Beta-selinene involves interaction with plant pathways affecting growth regulation and defense mechanisms, as well as providing distinctive aroma profiles due to its volatile nature.Formula:C15H24Purity:Min. 95%Molecular weight:204.35 g/mol


