CAS 175135-87-2

TERT-BUTYL 2-[(4-CHLOROPHENYL)THIO]-2-METHYLPROPANOATE

Description:

Tert-butyl 2-[(4-chlorophenyl)thio]-2-methylpropanoate is an organic compound characterized by its ester functional group, which is derived from tert-butyl alcohol and a thioether moiety. The presence of the 4-chlorophenyl group introduces a chlorine substituent on the aromatic ring, enhancing its reactivity and potential applications in various chemical reactions. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic tert-butyl group and the aromatic character of the chlorophenyl moiety. Its molecular structure suggests it may participate in nucleophilic substitution reactions, making it useful in synthetic organic chemistry. Additionally, the thioether linkage can impart unique properties, such as increased stability and altered electronic characteristics. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled. Overall, tert-butyl 2-[(4-chlorophenyl)thio]-2-methylpropanoate is a versatile compound with potential applications in pharmaceuticals and agrochemicals.

Formula: C₁₄H₁₉ClO₂S

InChI: InChI=1/C14H19ClO2S/c1-13(2,3)17-12(16)14(4,5)18-11-8-6-10(15)7-9-11/h6-9H,1-5H3

SMILES: CC(C)(C)OC(=O)C(C)(C)Sc1ccc(cc1)Cl

Synonyms:

• Tert-Butyl 2-(4-Chlorophenylthio)-2-Methylpropionate
• Tert-Butyl 2-[(4-Chlorophenyl)Sulfanyl]-2-Methylpropanoate

tert-butyl 2-[(4-chlorophenyl)thio]-2-methylpropanoate

CAS: 175135-87-2

tert-butyl 2-[(4-chlorophenyl)thio]-2-methylpropanoate

Purity: ≥95%

Molecular weight: 286.82g/mol

Ref: 54-OR21736