CAS 17518-47-7

1-Naphthaleneethanethioamide

Description:

1-Naphthaleneethanethioamide, with the CAS number 17518-47-7, is an organic compound characterized by its naphthalene moiety linked to an ethanethioamide functional group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the naphthalene ring, which contributes to its stability and potential interactions in various chemical environments. The thioamide functional group introduces unique reactivity, particularly in nucleophilic substitution reactions and coordination with metal ions. Additionally, 1-Naphthaleneethanethioamide may display moderate solubility in organic solvents, while its solubility in water is generally limited due to the hydrophobic nature of the naphthalene structure. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and material science. Its synthesis typically involves the reaction of naphthalene derivatives with thioamides, highlighting its relevance in organic synthesis and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₂H₁₁NS

InChI: InChI=1S/C12H11NS/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H2,13,14)

InChI key: InChIKey=FUDCGMJJFOGQFO-UHFFFAOYSA-N

SMILES: C(C(N)=S)C=1C2=C(C=CC1)C=CC=C2

Synonyms:

• 1-Naphthaleneacetamide, thio-
• 1-Naphthaleneethanethioamide
• 2-(1-Naphthyl)Thioacetamide
• 2-(Naphthalen-1-yl)ethanethioamide
• 2-Naphthalen-1-ylethanethioamide

2,3-DIhydro-1h-cyclopenta[c]quinoline-4-thiol

CAS: 17518-47-7

Formula: C₁₂H₁₁NS

Molecular weight: 201.2874

Ref: IN-DA0020DU

Naphazoline Impurity 1

CAS: 17518-47-7

Formula: C₁₂H₁₁NS

Color and Shape: White To Off-White Solid

Molecular weight: 201.29

Ref: 4Z-N-339

2-(Naphthalen-1-yl)ethanethioamide

CAS: 17518-47-7

2-(Naphthalen-1-yl)ethanethioamide is a phytohormone that belongs to the class of ethylene. It is involved in the regulation of many processes, including apical dominance, peduncle elongation, leaf senescence, and fruit ripening. 2-(Naphthalen-1-yl)ethanethioamide is an active form of ethylene that binds to the receptor protein ETR1. This binding stimulates the synthesis of proteins that regulate these processes. It has been shown to be effective in treating flowers with inflorescence stems and fruits with peduncles. The transformation process may involve hydrocarbon molecules with long aliphatic chains.

Formula: C₁₂H₁₁NS

Purity: Min. 95%

Molecular weight: 201.29 g/mol

Ref: 3D-SAA51847

Naphazoline Impurity 2

CAS: 17518-47-7

Formula: C₁₂H₁₁NS

Molecular weight: 201.3

Ref: ST-EA-CP-N48009