CAS 1803598-55-1

Pyridine, 2-chloro-6-(4-pyridinylmethyl)-, hydrochloride (1:1)

Description:

Pyridine, 2-chloro-6-(4-pyridinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chlorine substituent at the 2-position and a 4-pyridinylmethyl group at the 6-position, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, particularly water. The presence of the pyridine moieties suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity and environmental impact.

Formula: C₁₁H₉ClN₂·ClH

InChI: InChI=1S/C11H9ClN2.ClH/c12-11-3-1-2-10(14-11)8-9-4-6-13-7-5-9;/h1-7H,8H2;1H

InChI key: InChIKey=OKFWHSLNHNKSJT-UHFFFAOYSA-N

SMILES: C(C=1N=C(Cl)C=CC1)C=2C=CN=CC2.Cl

Synonyms:

• Pyridine, 2-chloro-6-(4-pyridinylmethyl)-, hydrochloride (1:1)

2-Chloro-6-[(pyridin-4-yl)methyl]pyridine hydrochloride

CAS: 1803598-55-1

Versatile small molecule scaffold

Formula: C₁₁H₁₀Cl₂N₂

Purity: Min. 95%

Molecular weight: 241.11 g/mol

Ref: 3D-DXC59855