CAS 1803598-58-4

1,4-Dimethyl 2-(difluoromethoxy)butanedioate

Description:

1,4-Dimethyl 2-(difluoromethoxy)butanedioate, identified by its CAS number 1803598-58-4, is an organic compound characterized by its unique structure, which includes two methyl groups and a difluoromethoxy substituent attached to a butanedioate backbone. This compound typically exhibits properties common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. Its molecular structure suggests it may have moderate polarity due to the presence of the difluoromethoxy group, which can influence its solubility in various solvents. The difluoromethoxy group also imparts potential reactivity, making it of interest in synthetic organic chemistry. Additionally, the presence of multiple functional groups may allow for various chemical transformations, making it a versatile intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₇H₁₀F₂O₅

InChI: InChI=1S/C7H10F2O5/c1-12-5(10)3-4(6(11)13-2)14-7(8)9/h4,7H,3H2,1-2H3

InChI key: InChIKey=FGLLQRDNAPGJMA-UHFFFAOYSA-N

SMILES: C(C(OC)=O)(CC(OC)=O)OC(F)F

Synonyms:

• Butanedioic acid, 2-(difluoromethoxy)-, 1,4-dimethyl ester
• 1,4-Dimethyl 2-(difluoromethoxy)butanedioate

1,4-Dimethyl 2-(difluoromethoxy)butanedioate

CAS: 1803598-58-4

Versatile small molecule scaffold

Formula: C₇H₁₀F₂O₅

Purity: Min. 95%

Molecular weight: 212.15 g/mol

Ref: 3D-DXC59858