CAS 18173-74-5
:(2-Methoxyethoxy)trimethylsilane
Description:
(2-Methoxyethoxy)trimethylsilane, with the CAS number 18173-74-5, is an organosilicon compound characterized by the presence of a trimethylsilane group attached to a methoxyethoxy functional group. This compound typically appears as a colorless liquid and is known for its low viscosity and moderate volatility. It is soluble in organic solvents and exhibits hydrophobic properties, making it useful in various applications, including as a silane coupling agent in the formulation of coatings, adhesives, and sealants. The presence of the methoxyethoxy group enhances its compatibility with polar substrates, while the trimethylsilane moiety contributes to its stability and reactivity. Additionally, this compound can participate in hydrolysis reactions, forming silanol groups that can further react with other materials to promote adhesion and improve surface properties. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, (2-Methoxyethoxy)trimethylsilane is valued in industrial applications for its unique chemical properties and versatility.
Formula:C6H16O2Si
InChI:InChI=1S/C6H16O2Si/c1-7-5-6-8-9(2,3)4/h5-6H2,1-4H3
InChI key:InChIKey=HRDKXAGASFLTCG-UHFFFAOYSA-N
SMILES:O([Si](C)(C)C)CCOC
Synonyms:- 1-Methoxy-2-(trimethylsiloxy)ethane
- (2-Methoxyethoxy)trimethylsilane
- Silane, (2-methoxyethoxy)trimethyl-
- Methyl 2-(trimethylsilyloxy)ethyl ether
- 1-Methoxy-2-(trimethylsilyloxy)ethane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
