CAS 1909294-32-1

(3R)-5-Oxo-3-(trifluoromethyl)-D-proline methyl ester

Description:

(3R)-5-Oxo-3-(trifluoromethyl)-D-proline methyl ester is a chemical compound characterized by its unique structural features, including a proline backbone with a ketone functional group and a trifluoromethyl substituent. This compound belongs to the class of amino acid derivatives and is notable for its potential applications in medicinal chemistry and drug development due to the presence of the trifluoromethyl group, which can enhance metabolic stability and lipophilicity. The methyl ester functionality allows for increased solubility and reactivity, making it a versatile intermediate in organic synthesis. The stereochemistry at the 3-position, indicated by the (3R) designation, is crucial for its biological activity, as chirality can significantly influence the interaction with biological targets. Overall, this compound's distinct characteristics make it a subject of interest for researchers exploring new therapeutic agents or studying the properties of amino acid derivatives.

Formula: C₇H₈F₃NO₃

InChI: InChI=1S/C7H8F3NO3/c1-14-6(13)5-3(7(8,9)10)2-4(12)11-5/h3,5H,2H2,1H3,(H,11,12)/t3-,5-/m1/s1

InChI key: InChIKey=FGLVXXYZFXCUQL-NQXXGFSBSA-N

SMILES: C(F)(F)(F)[C@H]1[C@H](C(OC)=O)NC(=O)C1

Synonyms:

• D-Proline, 5-oxo-3-(trifluoromethyl)-, methyl ester, (3R)-
• (3R)-5-Oxo-3-(trifluoromethyl)-D-proline methyl ester