CAS 19956-54-8

4-Methoxy-2-[(2E)-1-methoxy-3-phenyl-2-propen-1-ylidene]-4-cyclopentene-1,3-dione

Description:

4-Methoxy-2-[(2E)-1-methoxy-3-phenyl-2-propen-1-ylidene]-4-cyclopentene-1,3-dione, with CAS number 19956-54-8, is an organic compound characterized by its complex structure featuring a cyclopentene ring and multiple functional groups, including methoxy and carbonyl groups. This compound is part of the class of chalcones, which are known for their potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The presence of the methoxy groups enhances its solubility and reactivity, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various stereochemical configurations, which can influence its biological activity. Additionally, the compound may exhibit UV-Vis absorbance due to the conjugated double bonds, making it useful in photochemical applications. Overall, 4-Methoxy-2-[(2E)-1-methoxy-3-phenyl-2-propen-1-ylidene]-4-cyclopentene-1,3-dione represents a versatile scaffold for further chemical modifications and potential therapeutic applications.

Formula: C₁₆H₁₄O₄

InChI: InChI=1S/C16H14O4/c1-19-13(9-8-11-6-4-3-5-7-11)15-12(17)10-14(20-2)16(15)18/h3-10H,1-2H3/b9-8+,15-13?

InChI key: InChIKey=FITVJPYUOAZKPN-XEWNGCJOSA-N

SMILES: C(/C=C/C1=CC=CC=C1)(OC)=C2C(=O)C(OC)=CC2=O

Synonyms:

• Methyllucidone
• 4-Cyclopentene-1,3-dione, 4-methoxy-2-[(2E)-1-methoxy-3-phenyl-2-propenylidene]-
• 4-Methoxy-2-[(2E)-1-methoxy-3-phenyl-2-propen-1-ylidene]-4-cyclopentene-1,3-dione
• 4-Cyclopentene-1,3-dione, 4-methoxy-2-(α-methoxycinnamylidene)-
• 4-Cyclopentene-1,3-dione, 4-methoxy-2-[(2E)-1-methoxy-3-phenyl-2-propen-1-ylidene]-

4-Cyclopentene-1,3-dione, 4-methoxy-2-[(2E)-1-methoxy-3-phenyl-2-propen-1-ylidene]-

CAS: 19956-54-8

Formula: C₁₆H₁₄O₄

Molecular weight: 270.2800

Ref: IN-DA002C6F

Methyllucidone

CAS: 19956-54-8

Formula: C₁₆H₁₄O₄

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 270.284

Ref: BP-SBP00118

Methyllucidone

CAS: 19956-54-8

Methyllucidone is a synthetic organic compound that functions as a potential therapeutic agent. It is derived from a series of advanced organic synthesis processes, focused on creating a stable and bioactive molecular structure. The mode of action of Methyllucidone involves modulation of specific biochemical pathways, potentially influencing inflammatory responses at the cellular level. This modulation could lead to the downregulation of pro-inflammatory cytokines, thereby reducing inflammation and associated symptoms.

Formula: C₁₆H₁₄O₄

Purity: Min. 95%

Molecular weight: 270.28 g/mol

Ref: 3D-UAA95654

Methyllucidone

CAS: 19956-54-8

Methyllucidone is an inhibitor of STAT3 that acts by regulating the expression of the protein tyrosine phosphatase MEG2.

Formula: C₁₆H₁₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 270.28

Ref: TM-T19885