CAS 2016-45-7
:Hexadecyldimethylammonium chloride
Description:
Hexadecyldimethylammonium chloride, commonly referred to as HDAC, is a quaternary ammonium compound characterized by its long hydrophobic hydrocarbon chain and a positively charged nitrogen atom. This compound typically appears as a white to off-white solid or powder and is soluble in water and organic solvents, making it versatile in various applications. HDAC exhibits surfactant properties, allowing it to reduce surface tension and stabilize emulsions, which is beneficial in formulations such as detergents, disinfectants, and personal care products. Additionally, it possesses antimicrobial properties, making it effective in preserving products and preventing microbial growth. The compound's long alkyl chain contributes to its ability to interact with biological membranes, which can influence its toxicity and biocompatibility. Due to its quaternary ammonium structure, HDAC can also act as a cationic surfactant, facilitating the adsorption of other molecules onto surfaces. Safety considerations include potential skin and eye irritation, and it is essential to handle it with appropriate precautions in laboratory and industrial settings.
Formula:C18H39N·ClH
InChI:InChI=1S/C18H39N.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3;/h4-18H2,1-3H3;1H
InChI key:InChIKey=URXQDXAVUYKSCK-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)CCCCN(C)C.Cl
Synonyms:- N,N-Dimethylhexadecylamine hydrochloride
- Hexadecyldimethylammonium chloride
- N,N-dimethylhexadecan-1-aminium chloride
- Hexadecyldimethylammonium chloride
- N,N-Dimethyl-1-hexadecylamine hydrochloride
- 1-Hexadecanamine, N,N-dimethyl-, hydrochloride
- Dimethylhexadecylamine chlorhydrate
- 1-Hexadecanamine, N,N-dimethyl-, hydrochloride (1:1)
- Dimethylhexadecylamine chlorhydrate [French]
- Cetyldimethylamine hydrochloride
- Hexadecylamine, N,N-dimethyl-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
