CAS 20357-28-2
:(2E)-3-(5-chloro-2-nitrophenyl)prop-2-enoic acid
Description:
(2E)-3-(5-chloro-2-nitrophenyl)prop-2-enoic acid, with the CAS number 20357-28-2, is an organic compound characterized by its conjugated double bond system and the presence of both a chloro and a nitro substituent on the aromatic ring. This compound features a prop-2-enoic acid backbone, which indicates it has both an alkene and a carboxylic acid functional group. The presence of the 5-chloro and 2-nitro groups on the phenyl ring contributes to its chemical reactivity and potential biological activity, as these substituents can influence the compound's electronic properties and steric hindrance. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic ring may provide hydrophobic characteristics. Its structural features suggest potential applications in pharmaceuticals or agrochemicals, where such substituents can enhance biological activity or selectivity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with the chloro and nitro groups.
Formula:C9H6ClNO4
InChI:InChI=1/C9H6ClNO4/c10-7-2-3-8(11(14)15)6(5-7)1-4-9(12)13/h1-5H,(H,12,13)/b4-1+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Chloro-2-nitrocinnamic acid
CAS:5-Chloro-2-nitrocinnamic acid is a fine chemical with a CAS number of 20357-28-2. It is a versatile building block that can be used as a reaction component or intermediate in the synthesis of more complex compounds. The high purity and quality of 5-Chloro-2-nitrocinnamic acid makes it an ideal reagent for research purposes, and it can be used as a building block for the synthesis of useful scaffolds.
Formula:C9H6ClNO4Purity:Min. 95%Molecular weight:227.6 g/mol


