CAS 204376-00-1
:Thiodicarbonic diamide ([(H2N)C(S)]2S), N,N,N′,N′-tetrakis(2-methylpropyl)-
Description:
Thiodicarbonic diamide, with the chemical formula [(H2N)C(S)]2S and CAS number 204376-00-1, is a sulfur-containing organic compound characterized by its unique structure that includes two thioamide groups linked by a sulfur atom. This compound typically exhibits properties associated with thioamides, such as potential reactivity in nucleophilic substitution reactions and the ability to form coordination complexes with metals. It is often utilized in various chemical applications, including as a reagent in organic synthesis and potentially in agricultural chemistry due to its nitrogen content. The presence of multiple amine groups suggests that it may engage in hydrogen bonding, influencing its solubility and interaction with other substances. Additionally, the branched alkyl groups (2-methylpropyl) attached to the nitrogen atoms can enhance its lipophilicity, affecting its behavior in biological systems and its potential applications in pharmaceuticals or agrochemicals. Overall, thiodicarbonic diamide represents a versatile compound with interesting chemical properties and potential utility in various fields.
Formula:C18H36N2S3
InChI:InChI=1S/C18H36N2S3/c1-13(2)9-19(10-14(3)4)17(21)23-18(22)20(11-15(5)6)12-16(7)8/h13-16H,9-12H2,1-8H3
InChI key:InChIKey=NFZRSOHGHXZUPA-UHFFFAOYSA-N
SMILES:N(C(SC(N(CC(C)C)CC(C)C)=S)=S)(CC(C)C)CC(C)C
Synonyms:- N,N,N',N'-Tetraisobutylthiuram monosulfide
- N,N,N′,N′-Tetraisobutylthiuram monosulfide
- Thiodicarbonicdiamide ([(H2N)C(S)]2S), tetrakis(2-methylpropyl)- (9CI)
- Accelerator TiBTM
- Thiodicarbonic diamide ([(H2N)C(S)]2S), tetrakis(2-methylpropyl)-
- Cure-rite IBM
- Cure-rite IBM
- Thiodicarbonic diamide ([(H2N)C(S)]2S), N,N,N′,N′-tetrakis(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Thiodicarbonic diamide ([(H2N)C(S)]2S), N,N,N',N'-tetrakis(2-methylpropyl)-
CAS:Formula:C18H36N2S3Molecular weight:376.6868
