
CAS 20542-97-6
:Iron orthoborate
Description:
Iron orthoborate, with the CAS number 20542-97-6, is an inorganic compound composed of iron, boron, and oxygen. It typically appears as a crystalline solid and is known for its unique structural properties, which can include a layered or framework arrangement. This compound is often characterized by its high thermal stability and resistance to chemical degradation, making it suitable for various applications in materials science and ceramics. Iron orthoborate exhibits interesting magnetic properties, which can be influenced by the oxidation state of iron present in the compound. Additionally, it may display luminescent properties under certain conditions, making it of interest in optoelectronic applications. The compound is generally insoluble in water but can react with acids to form soluble boron and iron species. Its synthesis often involves the reaction of iron oxides with boron oxides at elevated temperatures. Overall, iron orthoborate is a versatile compound with potential applications in catalysis, electronics, and as a precursor for other boron-containing materials.
Formula:BH3O3·Fe
InChI:InChI=1S/BH3O3.Fe/c2-1(3)4;/h2-4H;
InChI key:InChIKey=CSPGAFZJGURCJF-UHFFFAOYSA-N
SMILES:B(O)(O)O.[Fe]
Synonyms:- Boric acid (H3BO3), iron(3+) salt (1:1)
- Iron borate (Fe(BO3))
- Ferric orthoborate (FeBO3)
- Ferric borate (FeBO3)
- Iron(III) orthoborate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
