CAS 2055048-43-4

1,1-Dimethylethyl 27-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-4,7,10,13,16,19,22,25-octaoxaheptacosanoate

Description:

1,1-Dimethylethyl 27-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-4,7,10,13,16,19,22,25-octaoxaheptacosanoate is a complex organic compound characterized by its long carbon chain and multiple functional groups. The presence of the octaoxaheptacosanoate moiety indicates a significant degree of oxygenation, which contributes to its potential solubility in polar solvents. The 2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl group suggests that the compound may exhibit unique reactivity and biological activity due to the pyrrole structure, which is known for its involvement in various biochemical processes. The dimethyl group attached to the ethyl group may enhance the steric hindrance, influencing the compound's interactions with other molecules. Overall, this compound's structural complexity suggests potential applications in fields such as pharmaceuticals, materials science, or as a surfactant, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₇H₄₇NO₁₂

InChI: InChI=1S/C27H47NO12/c1-27(2,3)40-26(31)6-8-32-10-12-34-14-16-36-18-20-38-22-23-39-21-19-37-17-15-35-13-11-33-9-7-28-24(29)4-5-25(28)30/h4-5H,6-23H2,1-3H3

InChI key: InChIKey=HAOLDMZFBZWLAI-UHFFFAOYSA-N

SMILES: C(COCCOCCOCCOCCOCCOCCOCCOCCC(OC(C)(C)C)=O)N1C(=O)C=CC1=O

Synonyms:

• 4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 27-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-4,7,10,13,16,19,22,25-octaoxaheptacosanoate

Mal-PEG8-t-butyl ester

CAS: 2055048-43-4

Formula: C₂₇H₄₇NO₁₂

Purity: 95%

Molecular weight: 577.6616

Ref: IN-DA019E8O

Mal-PEG8-Boc

CAS: 2055048-43-4

Mal-PEG8-Boc

Purity: 95%

Molecular weight: 577.66g/mol

Ref: 54-OR1034885

Mal-PEG8-Boc

CAS: 2055048-43-4

Purity: 95%

Molecular weight: 577.31

Ref: 10-F554686

Mal-PEG8-Boc

CAS: 2055048-43-4

Mal-PEG8-Boc, a PEG-based linker for PROTACs, connects two essential ligands, facilitating the formation of PROTAC molecules and enabling selective protein degradation by leveraging the ubiquitin-proteasome system within cells.

Formula: C₂₇H₄₇NO₁₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 577.66

Ref: TM-T16004