
CAS 2070015-27-7
:Description:
The chemical substance with the CAS number 2070015-27-7 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical properties (including reactivity and stability). Additionally, the compound may have specific applications in fields such as pharmaceuticals, agriculture, or materials science, depending on its functional groups and overall structure. To obtain precise information about this compound, including its safety data, toxicity, and potential uses, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) that provide comprehensive details on the substance.
Formula:C21H21ClD4N2O3·2ClH
InChI:InChI=1S/C21H25ClN2O3.2ClH/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26;;/h1-9,21H,10-16H2,(H,25,26);2*1H/i14D2,15D2;;
InChI key:InChIKey=PGLIUCLTXOYQMV-YOCDACDASA-N
SMILES:C(N1CCN(C(C(OCC(O)=O)([2H])[2H])([2H])[2H])CC1)(C2=CC=C(Cl)C=C2)C3=CC=CC=C3.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(±)-Cetirizine-d4 Dihydrochloride
CAS:Controlled Product<p>Applications (±)-Cetirizine-d4 Dihydrochloride is the labeled analogue of Cetirizine Dihydrochloride (C281100), a nonsedating type histamine H1-receptor antagonist. A major metabolite of Hydroxyzine. Pharmacological activity resides primarily in the (R)-isomer. Antihystaminic.<br>References De Vos, C., et al.: Ann. Allergy, 59, 278 (1987); Juhlin, L., et al.: J. Allergy Clin. Immunol., 80, 599 (1987); Fadel, R., et al.: Clin. Allergy, 17, 373 (1987); Gengo, F.M., et al.: Clin. Pharmacol. Ther., 42, 265 (1987)<br></p>Formula:C212H4H21ClN2O3·2ClHColor and Shape:White To Off-WhiteMolecular weight:465.83
