
CAS 2096334-63-1
:B-(3-Hydroxy-4-pyridinyl)boronic acid
Description:
B-(3-Hydroxy-4-pyridinyl)boronic acid, identified by its CAS number 2096334-63-1, is a boronic acid derivative characterized by the presence of a pyridine ring substituted with a hydroxyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The hydroxyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. Additionally, the pyridine moiety can participate in hydrogen bonding and π-π stacking interactions, which are significant in drug design and molecular recognition processes. The compound's unique structure allows it to act as a potential ligand in coordination chemistry and as a building block in the synthesis of more complex molecules. Overall, B-(3-Hydroxy-4-pyridinyl)boronic acid is a versatile compound with applications in both research and industry, particularly in the fields of pharmaceuticals and materials science.
Formula:C5H6BNO3
InChI:InChI=1S/C5H6BNO3/c8-5-3-7-2-1-4(5)6(9)10/h1-3,8-10H
InChI key:InChIKey=PCEHDQYNRQGNAU-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(O)=CN=CC1
Synonyms:- Boronic acid, B-(3-hydroxy-4-pyridinyl)-
- B-(3-Hydroxy-4-pyridinyl)boronic acid
- (3-Hydroxypyridin-4-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.