CAS 2097958-07-9
:3-[1-(2-Azidoethyl)-2-pyrrolidinyl]pyridine
Description:
3-[1-(2-Azidoethyl)-2-pyrrolidinyl]pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pyrrolidine moiety linked by an azidoethyl group. The presence of the azide functional group (-N3) suggests potential reactivity, particularly in click chemistry applications, where it can participate in cycloaddition reactions. The pyridine ring contributes to the compound's aromatic properties, potentially influencing its electronic characteristics and solubility. The pyrrolidine ring adds to the compound's cyclic structure, which may affect its conformational flexibility and steric interactions. This compound may exhibit biological activity due to its nitrogen-containing heterocycles, making it of interest in medicinal chemistry and drug development. Additionally, the azido group can serve as a handle for further functionalization, allowing for the synthesis of more complex molecules. Overall, 3-[1-(2-Azidoethyl)-2-pyrrolidinyl]pyridine is a versatile compound with potential applications in various fields, including organic synthesis and pharmacology.
Formula:C11H15N5
InChI:InChI=1S/C11H15N5/c12-15-14-6-8-16-7-2-4-11(16)10-3-1-5-13-9-10/h1,3,5,9,11H,2,4,6-8H2
InChI key:InChIKey=DMQGNQOVWCQHKB-UHFFFAOYSA-N
SMILES:C(CN=[N+]=[N-])N1C(CCC1)C=2C=CC=NC2
Synonyms:- Pyridine, 3-[1-(2-azidoethyl)-2-pyrrolidinyl]-
- 3-[1-(2-Azidoethyl)-2-pyrrolidinyl]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(1-(2-Azidoethyl)pyrrolidin-2-yl)pyridine
CAS:Controlled Product<p>Applications 3-(1-(2-azidoethyl)pyrrolidin-2-yl)pyridine (cas# 2097958-07-9) is a useful research chemical.<br></p>Formula:C10H15N5OColor and Shape:NeatMolecular weight:221.259
