CymitQuimica logo

CAS 2106-41-4

:

1,3-Difluoro-2,4-dinitrobenzene

Description:
1,3-Difluoro-2,4-dinitrobenzene is an aromatic compound characterized by the presence of two nitro groups and two fluorine substituents on a benzene ring. Its molecular formula is C6H3F2N2O4, indicating a relatively complex structure with both electronegative fluorine and nitro groups that significantly influence its chemical properties. This compound typically appears as a yellow crystalline solid and is known for its high reactivity, particularly in electrophilic substitution reactions due to the electron-withdrawing nature of the nitro groups. It is often used in organic synthesis and as an intermediate in the production of various chemical compounds. Additionally, 1,3-difluoro-2,4-dinitrobenzene exhibits toxicity and environmental persistence, necessitating careful handling and disposal. Its physical properties, such as melting point and solubility, can vary based on purity and specific conditions, but it is generally soluble in organic solvents. Safety data sheets should be consulted for detailed handling precautions and potential hazards associated with this compound.
Formula:C6H2F2N2O4
InChI:InChI=1S/C6H2F2N2O4/c7-3-1-2-4(9(11)12)5(8)6(3)10(13)14/h1-2H
InChI key:InChIKey=FMVDUSBGCFWYGL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(F)C(N(=O)=O)=CC=C1F
Synonyms:
  • Benzene, 1,3-difluoro-2,4-dinitro-
  • Difluorodinitrobenzene
  • NSC 83551
  • 1,3-Difluoro-2,4-dinitrobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.