CymitQuimica logo

CAS 213672-66-3

:

benzyl N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]carbamate

Description:
Benzyl N-[(1R,2S)-2-(hydroxymethyl)cyclohexyl]carbamate is a chemical compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. This compound features a benzyl group, providing it with aromatic characteristics, and a cyclohexyl moiety that contributes to its cyclic structure and potential steric effects. The presence of the hydroxymethyl group indicates that it has alcohol functionality, which can participate in hydrogen bonding and influence its solubility and reactivity. The specific stereochemistry denoted by (1R,2S) suggests that the compound has chiral centers, which can affect its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could influence its efficacy as a drug or therapeutic agent. Overall, its unique combination of functional groups and stereochemistry makes it a subject of interest for further research and applications in various chemical and biological contexts.
Formula:C15H21NO3
InChI:InChI=1/C15H21NO3/c17-10-13-8-4-5-9-14(13)16-15(18)19-11-12-6-2-1-3-7-12/h1-3,6-7,13-14,17H,4-5,8-11H2,(H,16,18)/t13-,14-/m1/s1
SMILES:c1ccc(cc1)COC(=N[C@@H]1CCCC[C@@H]1CO)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.