CAS 213672-73-2
:benzyl N-[(1S,6S)-6-(hydroxymethyl)cyclohex-3-en-1-yl]carbamate
Description:
Benzyl N-[(1S,6S)-6-(hydroxymethyl)cyclohex-3-en-1-yl]carbamate is a chemical compound characterized by its unique structure, which includes a carbamate functional group and a cyclohexene ring with a hydroxymethyl substituent. This compound is typically used in organic synthesis and may exhibit biological activity due to its structural features. The presence of the hydroxymethyl group suggests potential for hydrogen bonding and reactivity, while the carbamate moiety can influence solubility and stability. The stereochemistry indicated by the (1S,6S) configuration suggests specific spatial arrangements that can affect the compound's interactions with biological targets. As with many organic compounds, its properties such as solubility, melting point, and reactivity can vary based on environmental conditions. Safety data should be consulted for handling and usage, as compounds with similar structures can exhibit varying levels of toxicity or reactivity. Overall, this compound represents a specific class of organic molecules with potential applications in medicinal chemistry and materials science.
Formula:C15H19NO3
InChI:InChI=1/C15H19NO3/c17-10-13-8-4-5-9-14(13)16-15(18)19-11-12-6-2-1-3-7-12/h1-7,13-14,17H,8-11H2,(H,16,18)/t13-,14+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
