
CAS 215500-56-4
:4-[5-(Trifluoromethyl)-1H-pyrazol-1-yl]benzenamine
Description:
4-[5-(Trifluoromethyl)-1H-pyrazol-1-yl]benzenamine, with the CAS number 215500-56-4, is an organic compound characterized by its pyrazole and aniline functional groups. It features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the pyrazole ring contributes to its stability and reactivity, making it a candidate for various applications in medicinal chemistry and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the trifluoromethyl group is known to enhance the metabolic stability of compounds, making them more resistant to degradation. Overall, 4-[5-(Trifluoromethyl)-1H-pyrazol-1-yl]benzenamine is of interest in research for its unique structural features and potential applications in drug development.
Formula:C10H8F3N3
InChI:InChI=1S/C10H8F3N3/c11-10(12,13)9-5-6-15-16(9)8-3-1-7(14)2-4-8/h1-6H,14H2
InChI key:InChIKey=WHXPARGWUUDDPF-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N(N=CC1)C2=CC=C(N)C=C2
Synonyms:- Benzenamine, 4-[5-(trifluoromethyl)-1H-pyrazol-1-yl]-
- 4-[5-(Trifluoromethyl)-1H-pyrazol-1-yl]benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.