CAS 2294-43-1
:1-bromo-4-(prop-2-en-1-yl)benzene
Description:
1-Bromo-4-(prop-2-en-1-yl)benzene, also known as p-bromoallylbenzene, is an organic compound characterized by the presence of a bromine atom and an allyl group attached to a benzene ring. Its molecular structure features a bromine substituent at the para position relative to the allyl group, which consists of a three-carbon chain with a double bond. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is moderately soluble in organic solvents but has limited solubility in water due to the hydrophobic nature of the benzene ring. The presence of the bromine atom makes it a potential electrophile in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Additionally, the allyl group can participate in reactions such as polymerization and allylic rearrangements. Safety precautions should be taken when handling this compound, as it may pose health risks, including skin and respiratory irritation.
Formula:C9H9Br
InChI:InChI=1/C9H9Br/c1-2-3-8-4-6-9(10)7-5-8/h2,4-7H,1,3H2
SMILES:C=CCc1ccc(cc1)Br
Synonyms:- Benzene, 1-bromo-4-(2-propenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Bromo-4-(2-propen-1-yl)benzene
CAS:Formula:C9H9BrPurity:97%Color and Shape:LiquidMolecular weight:197.07181-Allyl-4-bromobenzene
CAS:<p>1-Allyl-4-bromobenzene</p>Formula:C9H9BrPurity:≥95%Color and Shape: colourless oilMolecular weight:197.07g/mol3-(4-Bromophenyl)-1-propene
CAS:Formula:C9H9BrPurity:97.0%Color and Shape:Liquid, OilMolecular weight:197.0751-allyl-4-bromo-benzene
CAS:<p>1-Allyl-4-bromobenzene is an organic compound with a chemical formula of C6H5CH2Br. It belongs to the class of heterocyclic compounds known as allylbenzenes, which are analogues of benzoic acid. 1-Allyl-4-bromobenzene is a reagent in Suzuki coupling reactions, which are chemical reactions that involve the use of a palladium catalyst and an organic boronate reagent to form carbon–carbon bonds. This product has been shown to be useful as an inhibitor for protein kinases, and has also been used for the synthesis of analogues.</p>Formula:C9H9BrPurity:Min. 95%Molecular weight:197.07 g/mol



