CAS 24347-63-5
:(S)-Methyl 2-hydroxy-3-methylbutanoate
Description:
(S)-Methyl 2-hydroxy-3-methylbutanoate, with the CAS number 24347-63-5, is an organic compound characterized by its ester functional group and chiral center, which contributes to its specific stereochemistry. This compound features a methyl ester derived from a branched-chain carboxylic acid, specifically 2-hydroxy-3-methylbutanoic acid. It is typically a colorless to pale yellow liquid with a pleasant fruity odor, making it of interest in flavor and fragrance applications. The presence of the hydroxyl group (–OH) enhances its solubility in polar solvents, while the ester group contributes to its volatility and reactivity. As a chiral molecule, it can exist in two enantiomeric forms, with the (S)-configuration being one of them, which may exhibit different biological activities or sensory properties compared to its (R)-counterpart. This compound is utilized in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its safety and handling should adhere to standard protocols for organic chemicals, considering potential irritant properties.
Formula:C6H12O3
InChI:InChI=1/C6H12O3/c1-4(2)5(7)6(8)9-3/h4-5,7H,1-3H3/t5-/m0/s1
SMILES:CC(C)[C@@H](C(=O)OC)O
Synonyms:- butanoic acid, 2-hydroxy-3-methyl-, methyl ester, (2S)-
- Methyl (2S)-2-hydroxy-3-methylbutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(S)-Hydroxy-3-Methylbutyric Acid Methyl Ester
CAS:Formula:C6H12O3Purity:95%Color and Shape:LiquidMolecular weight:132.1577(S)-Methyl 2-hydroxy-3-methylbutanoate
CAS:(S)-Methyl 2-hydroxy-3-methylbutanoateFormula:C6H12O3Purity:97%Color and Shape: colourless liquidMolecular weight:132.16g/mol(S)-Methyl 2-hydroxy-3-methylbutanoate
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:132.15899658203125(S)-Methyl 2-hydroxy-3-methylbutanoate
CAS:(S)-Methyl 2-hydroxy-3-methylbutanoate is a versatile compound that has various applications in different industries. It is commonly used as a plasticizer, herbicide, and anticoagulant. In the field of agriculture, it acts as an effective herbicide by inhibiting the growth of unwanted plants. Additionally, it serves as a plasticizer in the manufacturing of plastics, providing flexibility and durability to the final product.Formula:C6H12O3Purity:Min. 95%Molecular weight:132.16 g/mol



