CAS 254101-10-5
:Boc-L-beta-glutamic acid 5-benzyl ester
Description:
Boc-L-beta-glutamic acid 5-benzyl ester is a chemical compound commonly used in peptide synthesis and medicinal chemistry. It features a tert-butyloxycarbonyl (Boc) protecting group, which is often employed to protect amino groups during chemical reactions. The compound contains a beta-glutamic acid backbone, which is an amino acid that plays a role in protein structure and function. The presence of the benzyl ester group enhances its lipophilicity, making it more soluble in organic solvents, which is advantageous for various synthetic applications. This compound is typically utilized in the preparation of peptides and other derivatives due to its ability to undergo selective reactions while maintaining the integrity of the Boc and benzyl ester groups. Its molecular structure allows for specific interactions in biological systems, making it of interest in drug design and development. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C17H23NO6
InChI:InChI=1/C17H23NO6/c1-17(2,3)24-16(22)18-13(9-14(19)20)10-15(21)23-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,18,22)(H,19,20)/t13-/m1/s1
SMILES:CC(C)(C)OC(=N[C@H](CC(=O)O)CC(=O)OCc1ccccc1)O
Synonyms:- Boc-L-beta-homoaspartic acid 5-benzyl ester
- Boc-beta-Glu(OBzl)-OH
- (3R)-5-(benzyloxy)-3-[(tert-butoxycarbonyl)amino]-5-oxopentanoic acid
- Boc-β-HoAsp(OBzl)-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Boc-L-β-glutamic acid 5-benzyl ester, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C17H23NO6Purity:95%Molecular weight:337.37(3R)-5-(benzyloxy)-3-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
CAS:Formula:C17H23NO6Purity:98%Color and Shape:SolidMolecular weight:337.3676Boc-ß-HoAsp(OBzl)-OH
CAS:<p>M06105 - Boc-ß-HoAsp(OBzl)-OH</p>Formula:C17H23NO6Purity:95%Color and Shape:Solid, No data available.Molecular weight:337.372




