CAS 25667-98-5
:Poly(o-phenylenediamine)
Description:
Poly(o-phenylenediamine) (PoPD) is a conducting polymer characterized by its unique structure and properties. It is synthesized through the oxidative polymerization of o-phenylenediamine, resulting in a polymer with repeating units that contribute to its electrical conductivity. PoPD exhibits excellent thermal stability and mechanical strength, making it suitable for various applications, including sensors, batteries, and electrochromic devices. The polymer is typically soluble in organic solvents, which facilitates processing and integration into composite materials. Its electrical properties can be tuned by doping or through chemical modifications, allowing for enhanced conductivity. Additionally, PoPD demonstrates good environmental stability and resistance to degradation, which is advantageous for long-term applications. The material's ability to undergo redox reactions enables its use in electrochemical applications, where it can act as an electron donor or acceptor. Overall, Poly(o-phenylenediamine) is a versatile material with significant potential in advanced technological applications due to its conductive and structural properties.
Formula:(C6H8N2)x
InChI:InChI=1S/C6H8N2/c7-5-3-1-2-4-6(5)8/h1-4H,7-8H2
InChI key:InChIKey=GEYOCULIXLDCMW-UHFFFAOYSA-N
SMILES:NC1=C(N)C=CC=C1
Synonyms:- 1,2-Benzenediamine, homopolymer
- Poly(o-phenylenediamine)
- o-Phenylenediamine, polymers
- o-Phenylenediamine polymer
- Poly(1,2-diaminobenzene)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
