CAS 257624-96-7

2-{[4-(trifluoromethyl)pyridin-2-yl]oxy}ethyl 4-methoxybenzoate

Description:

2-{[4-(Trifluoromethyl)pyridin-2-yl]oxy}ethyl 4-methoxybenzoate is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a trifluoromethyl group and an ether linkage to an ethyl group. The compound features an ester functional group derived from 4-methoxybenzoic acid, contributing to its potential applications in pharmaceuticals or agrochemicals. The presence of the trifluoromethyl group enhances lipophilicity and may influence biological activity, while the methoxy group can affect solubility and reactivity. This compound is likely to exhibit moderate to high stability under standard conditions, although specific reactivity can depend on environmental factors such as pH and temperature. Its molecular interactions may be significant in biological systems, making it a candidate for further research in medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and usage, given the potential toxicity associated with fluorinated compounds.

Formula: C₁₆H₁₄F₃NO₄

InChI: InChI=1/C16H14F3NO4/c1-22-13-4-2-11(3-5-13)15(21)24-9-8-23-14-10-12(6-7-20-14)16(17,18)19/h2-7,10H,8-9H2,1H3

SMILES: COc1ccc(cc1)C(=O)OCCOc1cc(ccn1)C(F)(F)F

2-{[4-(trifluoromethyl)-2-pyridyl]oxy}ethyl 4-methoxybenzoate

CAS: 257624-96-7

2-{[4-(trifluoromethyl)-2-pyridyl]oxy}ethyl 4-methoxybenzoate

Purity: ≥95%

Molecular weight: 341.28g/mol

Ref: 54-PC32409