CAS 284682-04-8
:2-(butylsulfanyl)-6-(naphthalen-2-ylsulfanyl)pyrimidin-4(3H)-one
Description:
2-(Butylsulfanyl)-6-(naphthalen-2-ylsulfanyl)pyrimidin-4(3H)-one is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with both butylsulfanyl and naphthalen-2-ylsulfanyl groups. This compound features a pyrimidinone moiety, indicating the presence of a carbonyl group adjacent to the nitrogen atoms in the ring. The butylsulfanyl group contributes to the compound's hydrophobic characteristics, while the naphthalenyl group adds aromaticity and potential for π-π stacking interactions. The presence of sulfur atoms in the substituents may enhance the compound's reactivity and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structural features suggest potential applications in various fields, including drug design and materials science. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C18H18N2OS2
InChI:InChI=1/C18H18N2OS2/c1-2-3-10-22-18-19-16(21)12-17(20-18)23-15-9-8-13-6-4-5-7-14(13)11-15/h4-9,11-12H,2-3,10H2,1H3,(H,19,20,21)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Butylthio)-6-(naphthalen-2-ylthio)pyrimidin-4(1H)-one
CAS:Formula:C18H18N2OS2Molecular weight:342.4783
