CAS 286013-07-8
:cyanuric-13C3 chloride
Description:
Cyanuric-13C3 chloride, with the CAS number 286013-07-8, is a chlorinated derivative of cyanuric acid, specifically labeled with carbon-13 isotopes. This compound is characterized by its cyclic triazine structure, which consists of three nitrogen atoms and three carbon atoms arranged in a ring, with chlorine substituents that enhance its reactivity. The incorporation of carbon-13 isotopes allows for applications in isotopic labeling and tracing in various chemical and biological studies. Cyanuric-13C3 chloride is typically used in research settings, particularly in the synthesis of other chemical compounds or in studies involving reaction mechanisms. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and the presence of other solvents or reagents. As with many chlorinated compounds, it is essential to handle cyanuric-13C3 chloride with care due to potential toxicity and environmental concerns associated with chlorinated organic compounds. Proper safety protocols should be followed when working with this substance in laboratory settings.
Formula:C3Cl3N3
InChI:InChI=1/C3Cl3N3/c4-1-7-2(5)9-3(6)8-1/i1+1,2+1,3+1
Synonyms:- 2,4,6-trichloro(13C3)-1,3,5-triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
