CAS 29336-53-6

(4-hydroxy-2-methylphenyl)acetic acid

Description:

(4-Hydroxy-2-methylphenyl)acetic acid, with the CAS number 29336-53-6, is an organic compound characterized by its aromatic structure and functional groups. It features a phenolic hydroxyl group and a carboxylic acid group, which contribute to its chemical reactivity and solubility properties. The presence of the methyl group at the 2-position of the phenyl ring influences its steric and electronic properties, potentially affecting its biological activity. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents like water and alcohols due to the hydroxyl and carboxylic acid functionalities. It may exhibit antioxidant properties and has been studied for its potential applications in pharmaceuticals and as a biochemical reagent. As with many organic acids, it can participate in various chemical reactions, including esterification and amidation, making it a versatile compound in organic synthesis. Proper handling and storage are essential, as with all chemical substances, to ensure safety and stability.

Formula: C₉H₁₀O₃

InChI: InChI=1/C9H10O3/c1-6-4-8(10)3-2-7(6)5-9(11)12/h2-4,10H,5H2,1H3,(H,11,12)

SMILES: Cc1cc(ccc1CC(=O)O)O

4-Hydroxy-2-methylphenylacetic acid

CAS: 29336-53-6

4-Hydroxy-2-methylphenylacetic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 166.17g/mol

Ref: 54-OR52226

2-(4-Hydroxy-2-methylphenyl)acetic acid

CAS: 29336-53-6

2-(4-Hydroxy-2-methylphenyl)acetic acid is an ester that has been shown to yield high yields of indanones in clean and simple reactions. The bifunctional nature of the molecule makes it suitable for use in photochemical reactions, including those with triplet states. 2-(4-Hydoxy-2-methylphenyl)acetic acid is also used synthetically as a low water solvent and anhydrous conditions.

Formula: C₉H₁₀O₃

Purity: Min. 95%

Molecular weight: 166.17 g/mol

Ref: 3D-EBA33653