CAS 2936-83-6
:(7E,10E)-hexadeca-7,10-dienoic acid
Description:
(7E,10E)-hexadeca-7,10-dienoic acid, also known as palmitoleic acid, is a long-chain unsaturated fatty acid characterized by its two double bonds located at the 7th and 10th carbon atoms in the carbon chain. This compound has a molecular formula of C16H28O2 and features a carboxylic acid functional group, which contributes to its acidic properties. The presence of double bonds in the cis configuration imparts fluidity to the molecule, influencing its physical properties such as melting point and solubility. It is typically found in various natural sources, including certain plant oils and animal fats. This fatty acid plays a role in various biological processes, including cellular signaling and metabolism. Additionally, it is of interest in the food industry and nutritional studies due to its potential health benefits, such as anti-inflammatory properties. Its CAS number, 2936-83-6, is a unique identifier used for regulatory and safety purposes in chemical databases.
Formula:C16H28O2
InChI:InChI=1/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h6-7,9-10H,2-5,8,11-15H2,1H3,(H,17,18)/b7-6+,10-9+
Synonyms:- 2936-83-6
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
