
CAS 303150-12-1
:1-[4-(4-Chlorophenyl)-2-thiazolyl]-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine
Description:
1-[4-(4-Chlorophenyl)-2-thiazolyl]-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine, with CAS number 303150-12-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a piperazine core substituted with both thiazole and pyridine moieties. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of halogen substituents, specifically chlorine and trifluoromethyl groups, often enhances the lipophilicity and biological activity of the molecule. Its thiazole and pyridine rings contribute to its potential interactions with biological targets, which may include receptors or enzymes. The compound's unique structure suggests it could be investigated for pharmacological applications, particularly in the fields of neuropharmacology or as a potential therapeutic agent. However, specific data regarding its toxicity, stability, and detailed biological activity would require further empirical studies and characterization.
Formula:C19H15Cl2F3N4S
InChI:InChI=1S/C19H15Cl2F3N4S/c20-14-3-1-12(2-4-14)16-11-29-18(26-16)28-7-5-27(6-8-28)17-15(21)9-13(10-25-17)19(22,23)24/h1-4,9-11H,5-8H2
InChI key:InChIKey=HFMODXOHUMSDLU-UHFFFAOYSA-N
SMILES:ClC1=C(N2CCN(C3=NC(=CS3)C4=CC=C(Cl)C=C4)CC2)N=CC(C(F)(F)F)=C1
Synonyms:- 1-[4-(4-Chlorophenyl)-2-thiazolyl]-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazine
- Piperazine, 1-[4-(4-chlorophenyl)-2-thiazolyl]-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.