CAS 31375-02-7

1,4-Benzenedisulfonic acid

Description:

1,4-Benzenedisulfonic acid, also known as p-benzenedisulfonic acid, is an aromatic sulfonic acid characterized by the presence of two sulfonic acid groups (-SO3H) attached to a benzene ring at the 1 and 4 positions. This compound is typically a white to light yellow crystalline solid that is soluble in water, making it useful in various applications. It has a high melting point and exhibits strong acidity due to the presence of the sulfonic acid groups. 1,4-Benzenedisulfonic acid is often utilized in the synthesis of dyes, pigments, and as a reagent in organic chemistry. Additionally, it can serve as a precursor for the production of other sulfonated compounds. Its chemical structure contributes to its reactivity, allowing it to participate in electrophilic substitution reactions. Safety precautions should be observed when handling this compound, as it can be corrosive and may cause irritation to the skin and eyes.

Formula: C₆H₆O₆S₂

InChI: InChI=1S/C6H6O6S2/c7-13(8,9)5-1-2-6(4-3-5)14(10,11)12/h1-4H,(H,7,8,9)(H,10,11,12)

InChI key: InChIKey=OATNQHYJXLHTEW-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=CC=C(S(=O)(=O)O)C=C1

Synonyms:

• 1,4-Benzenedisulfonic acid
• p-Benzenedisulfonic acid

Benzene-1,4-disulfonic acid

CAS: 31375-02-7

Please enquire for more information about Benzene-1,4-disulfonic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₆H₆O₆S₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 238.2 g/mol

Ref: 3D-GBA37502