CAS 325721-48-0

4-[[(4-Fluoro-2-methylphenyl)sulfonyl]amino]benzoic acid

Description:

4-[[(4-Fluoro-2-methylphenyl)sulfonyl]amino]benzoic acid, with the CAS number 325721-48-0, is a chemical compound characterized by its sulfonamide functional group and a carboxylic acid moiety. This compound features a fluorinated aromatic ring, which contributes to its unique chemical properties and potential biological activity. The presence of the sulfonyl group enhances its solubility in polar solvents and may influence its interaction with biological targets. The compound is likely to exhibit moderate to high stability under standard conditions, although specific stability can depend on environmental factors such as pH and temperature. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the sulfonamide and carboxylic acid functionalities, which are known to participate in various biochemical interactions. Additionally, the fluorine substitution may enhance lipophilicity and metabolic stability, making it a candidate for further research in drug development.

Formula: C₁₄H₁₂FNO₄S

InChI: InChI=1S/C14H12FNO4S/c1-9-8-11(15)4-7-13(9)21(19,20)16-12-5-2-10(3-6-12)14(17)18/h2-8,16H,1H3,(H,17,18)

InChI key: InChIKey=CLSQZYJXLKEAAT-UHFFFAOYSA-N

SMILES: S(NC1=CC=C(C(O)=O)C=C1)(=O)(=O)C2=C(C)C=C(F)C=C2

Synonyms:

• Benzoic acid, 4-[[(4-fluoro-2-methylphenyl)sulfonyl]amino]-
• 4-[[(4-Fluoro-2-methylphenyl)sulfonyl]amino]benzoic acid

4-(4-Fluoro-2-methylbenzenesulfonamido)benzoic acid

CAS: 325721-48-0

Versatile small molecule scaffold

Formula: C₁₄H₁₂FNO₄S

Purity: Min. 95%

Molecular weight: 309.31 g/mol

Ref: 3D-ANA72148