CAS 33214-36-7

3-(3-methoxyphenyl)-3-methylbutanoic acid

Description:

3-(3-Methoxyphenyl)-3-methylbutanoic acid, identified by its CAS number 33214-36-7, is an organic compound characterized by its unique structure, which includes a branched alkyl chain and an aromatic ring. This compound features a methoxy group (-OCH3) attached to a phenyl ring, contributing to its hydrophobic characteristics and potential for various interactions in biological systems. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit acidic properties. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or analgesic agents, due to the presence of both aromatic and aliphatic components. Additionally, the compound's solubility and reactivity can be influenced by the methoxy group, which may enhance its bioavailability. Overall, 3-(3-methoxyphenyl)-3-methylbutanoic acid is a compound of interest in organic chemistry and medicinal chemistry, warranting further investigation into its properties and potential applications.

Formula: C₁₂H₁₆O₃

InChI: InChI=1/C12H16O3/c1-12(2,8-11(13)14)9-5-4-6-10(7-9)15-3/h4-7H,8H2,1-3H3,(H,13,14)

SMILES: CC(C)(CC(=O)O)c1cccc(c1)OC

3-(3-Methoxyphenyl)-3-methylbutanoic acid

CAS: 33214-36-7

3-(3-Methoxyphenyl)-3-methylbutanoic acid

Purity: ≥95%

Molecular weight: 208.25g/mol

Ref: 54-OR306034